RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0966 |
| Common Name | cis-Zeatin |
| Synonyms Names | (Z)-2-Methyl-4-(1H-purin-6-ylamino)but-2-en-1-ol |
| Formula | C10H13N5O |
| Formula at pH 7.2 (Predicted) | C10H13N5O |
| Molecular Weight | 219.243 |
| Structure |  |
| SMILES | OCC(=CCNc1ncnc2c1[nH]cn2)C |
| Reactions | OSR0767 OSR1592 OSR1598 OSR1602 OSR2247 |
| Pathways | |
|---|---|
| KEGG | rn00908 |
| Metacyc | PWY-2902 PWY-2881 PWY-2901 PWY-2841 |
| Database Links | |
|---|---|
| Gramene | CPD-4441 |
| KEGG | C15545 |
| Pubchem Compound | 688597 |
| Pubchem Substance | 17396537 |