RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0974 |
| Common Name | 1D-myo-Inositol 3-phosphate |
| Synonyms Names | D-myo-Inositol 3-phosphate ;myo-Inositol 3-phosphate ;Inositol 3-phosphate ;1D-myo-Inositol 3-monophosphate ;D-myo-Inositol 3-monophosphate ;myo-Inositol 3-monophosphate ;Inositol 3-monophosphate ;1L-myo-Inositol 1-phosphate ;L-myo-Inositol 1-phosphate |
| Formula | C6H13O9P |
| Formula at pH 7.2 (Predicted) | C6H11O9P2- |
| Molecular Weight | 260.136 |
| Structure |  |
| SMILES | OC1C(OP(=O)(O)O)C(O)C(C(C1O)O)O |
| Reactions | OSR0408 OSR0458 |
| Pathways | |
|---|---|
| KEGG | rn00521 rn00562 rn01100 rn01110 |
| Metacyc | PWY-4661 PWY-6372 PWY-6664 PWY-6580 PWY1G-0 PWY-2301 |
| Database Links | |
|---|---|
| KEGG | C04006 |
| ChEBI | 18169 |
| Pubchem Compound | 440194 |
| Pubchem Substance | 6716 |