RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0976 |
| Common Name | alpha-D-Glucose 6-phosphate |
| Formula | C6H13O9P |
| Formula at pH 7.2 (Predicted) | C6H11O9P2- |
| Molecular Weight | 260.136 |
| Structure |  |
| SMILES | C(OP(O)(O)=O)C1(C(O)C(O)C(O)C(O1)O) |
| Reactions | OSR0386 OSR0391 OSR0396 OSR0399 OSR0882 OSR1202 OSR1606 |
| Pathways | |
|---|---|
| KEGG | rn00010 rn00030 rn01100 rn01110 rn01120 rn00052 rn00500 rn00520 |
| Metacyc | P61-PWY PWY-622 PWY-842 PWY-621 PWY-3801 SUCSYN-PWY TRESYN-PWY |
| Database Links | |
|---|---|
| KEGG | C00668 |
| ChEBI | 17665 |