RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0981 |
| Common Name | L-Galactose 1-phosphate(none in Pubchem Compound) |
| Formula | C6H13O9P |
| Formula at pH 7.2 (Predicted) | C6H11O9P2- |
| Molecular Weight | 260.136 |
| Structure |  |
| SMILES | OCC1OC(O[P](O)(O)=O)C(O)C(O)C1O |
| Reactions | OSR0454 OSR1237 |
| Pathways | |
|---|---|
| KEGG | rn00053 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C15926 |
| ChEBI | 53072 |
| Pubchem Compound | 23724607 |
| Pubchem Substance | 47205244 |