RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0984 |
| Common Name | alpha-D-Galactose 1-phosphate |
| Synonyms Names | alpha-D-Galactopyranose 1-phosphate |
| Formula | C6H13O9P |
| Formula at pH 7.2 (Predicted) | C6H11O9P2- |
| Molecular Weight | 260.136 |
| Structure |  |
| SMILES | C(O)C1(OC(OP(O)(O)=O)C(O)C(O)C1O) |
| Reactions | OSR1193 OSR1241 OSR1607 |
| Pathways | |
|---|---|
| KEGG | rn00052 rn00520 rn01100 rn01110 |
| Metacyc | PWY-3821 GALACTMETAB-PWY |
| Database Links | |
|---|---|
| KEGG | C00446 |
| ChEBI | 17973 |