RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0985 |
| Common Name | D-Tagatose 6-phosphate |
| Formula | C6H13O9P |
| Formula at pH 7.2 (Predicted) | C6H11O9P2- |
| Molecular Weight | 260.136 |
| Structure |  |
| SMILES | OCC1(O)OC(C(C1O)O)COP(=O)(O)O |
| Reactions | OSR1244 OSR1260 OSR1293 OSR1326 |
| Pathways | |
|---|---|
| KEGG | rn00052 rn01100 |
| Database Links | |
|---|---|
| KEGG | C01097 |
| ChEBI | 4251 |
| Pubchem Compound | 439396 |
| Pubchem Substance | 4332 |