RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0990 |
| Common Name | Uridine |
| Formula | C9H12N2O6 |
| Formula at pH 7.2 (Predicted) | C9H12N2O6 |
| Molecular Weight | 244.201 |
| Structure |  |
| SMILES | c1(n(c(=O)[nH]c(c1)=O)C2(C(O)C(O)C(O2)CO)) |
| Reactions | OSR0453 OSR0555 OSR0559 OSR1227 OSR1248 OSR1249 OSR1284 OSR1288 OSR1302 OSR1327 OSR1349 OSR1465 OSR2343 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 |
| Metacyc | PWY0-163 P1-PWY DRIBOPMET-PWY |
| Database Links | |
|---|---|
| KEGG | C00299 |
| ChEBI | 16704 |