RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0993 |
| Common Name | Deoxycytidine |
| Synonyms Names | 2'-Deoxycytidine |
| Formula | C9H13N3O4 |
| Formula at pH 7.2 (Predicted) | C9H13N3O4 |
| Molecular Weight | 227.217 |
| Structure |  |
| SMILES | c1(n(c(=O)nc(c1)N)C2(OC(C(C2)O)CO)) |
| Reactions | OSR0455 OSR0560 |
| Pathways | |
|---|---|
| KEGG | rn00240 |
| Metacyc | PWY0-181 DRIBOPMET-PWY |
| Database Links | |
|---|---|
| KEGG | C00881 |
| ChEBI | 15698 |