RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0996 |
| Common Name | Nucleoside diphosphate |
| Synonyms Names | C00454 ;NDP |
| Formula | C5H11O10P2R |
| Formula at pH 7.2 (Predicted) | C5H9O1P2R2- |
| Structure |  |
| SMILES | OC1C(OC(CO[P](O)(=O)O[P](O)(O)=O)C1O)[R] |
| Reactions | OSR0716 OSR1095 OSR1537 OSR1861 OSR2363 |
| Pathways | |
|---|---|
| KEGG | rn00620 rn00710 rn01100 rn01120 rn01110 rn00230 rn00240 |
| Metacyc | PWY-6126 PWY-6125 PPGPPMET-PWY PWY0-166 PWY-6545 PWY-5687 PWY0-163 |
| Database Links | |
|---|---|
| KEGG | C00454 |
| Pubchem Substance | 3740 |