RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0999 |
| Common Name | 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate |
| Synonyms Names | 4-Amino-2-methyl-5-diphosphomethylpyrimidine |
| Formula | C6H11N3O7P2 |
| Formula at pH 7.2 (Predicted) | C6H9N3O7P22- |
| Molecular Weight | 299.115 |
| Structure |  |
| SMILES | c1(c(c(N)nc(C)n1)COP(O)(=O)OP(O)(=O)O) |
| Reactions | OSR0878 OSR1196 |
| Pathways | |
|---|---|
| KEGG | rn00730 rn01100 |
| Metacyc | THISYN-PWY |
| Database Links | |
|---|---|
| KEGG | C04752 |
| ChEBI | 16629 |