RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1000 |
| Common Name | 1-Alkyl-2-acylglycerophosphoethanolamine |
| Synonyms Names | C04475 ;1-Radyl-2-acyl-sn-glycero-3-phosphoethanolamine ;2-Acyl-1-alkyl-sn-glycero-3-phosphoethanolamine ;1-Organyl-2-acyl-sn-glycero-3-phosphoethanolamine ;O-1-Alkyl-2-acyl-sn-glycero-3-phosphoethanolamine |
| Formula | C6H14NO7P |
| Formula at pH 7.2 (Predicted) | C6H14NO7P |
| Structure |  |
| SMILES | C(COP(=O)(O)OCC(CO)OC=O)N |
| Reactions | OSR1056 |
| Pathways | |
|---|---|
| KEGG | rn00565 rn01100 |
| Database Links | |
|---|---|
| KEGG | C04475 |
| Pubchem Substance | 7095 |