RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1002 |
| Common Name | L-Selenocystathionine |
| Formula | C7H14N2O4Se |
| Formula at pH 7.2 (Predicted) | C7H14N2O4Se |
| Molecular Weight | 269.157 |
| Structure |  |
| SMILES | NC(C(=O)O)CC[Se]CC(C(=O)O)N |
| Reactions | OSR0459 OSR0554 OSR0558 OSR0672 |
| Pathways | |
|---|---|
| KEGG | rn00450 |
| Database Links | |
|---|---|
| KEGG | C05699 |
| Pubchem Compound | 441455 |
| Pubchem Substance | 8006 |