RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1004 |
| Common Name | 5-Fluorouridine |
| Formula | C9H11FN2O6 |
| Formula at pH 7.2 (Predicted) | C9H11FN2O6 |
| Molecular Weight | 262.192 |
| Structure |  |
| SMILES | OCC1OC(C(C1O)O)n1cc(F)c(=O)[nH]c1=O |
| Reactions | OSR1310 |
| Pathways | |
|---|---|
| KEGG | rn00983 |
| Database Links | |
|---|---|
| KEGG | C16633 |
| ChEBI | 40154 |
| Pubchem Compound | 9427 |
| Pubchem Substance | 51090959 |