RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1011 |
| Common Name | 3,3',4'5-Tetrahydroxystilbene |
| Synonyms Names | Piceatannol |
| Formula | C14H12O4 |
| Formula at pH 7.2 (Predicted) | C14H12O4 |
| Molecular Weight | 244.243 |
| Structure |  |
| SMILES | Oc1cc(C=Cc2ccc(c(c2)O)O)cc(c1)O |
| Reactions | OSR0413 |
| Pathways | |
|---|---|
| KEGG | rn00945 rn01110 |
| Database Links | |
|---|---|
| KEGG | C05901 |
| ChEBI | 28814 |
| Pubchem Compound | 667639 |
| Pubchem Substance | 8189 |