RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1012 |
| Common Name | Apigenin |
| Synonyms Names | 4',5,7-Trihydroxyflavone ;5,7,4'-Trihydroxyflavone ;apigenin ;apigenin |
| Formula | C15H10O5 |
| Formula at pH 7.2 (Predicted) | C15H9O5- |
| Molecular Weight | 270.237 |
| Structure |  |
| SMILES | OC1=CC=C(C=C1)C2=CC(=O)C3=C(O)C=C(O)C=C3O2 |
| Reactions | OSR0436 OSR0794 OSR0830 OSR1389 OSR1486 OSR2116 OSR2124 OSR2127 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn00941 rn00943 rn01100 rn00944 |
| Metacyc | PWY1F-FLAVSYN PWY-5363 PWY-2083 PWY-5060 |
| Database Links | |
|---|---|
| Gramene | CPD-431 CPD-431 |
| KEGG | C01477 |
| ChEBI | 18388 |