RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1014 |
| Common Name | Galangin |
| Synonyms Names | 3,5,7-Trihydroxyflavone |
| Formula | C15H10O5 |
| Formula at pH 7.2 (Predicted) | C15H9O5- |
| Molecular Weight | 270.237 |
| Structure |  |
| SMILES | Oc1cc(O)c2c(c1)oc(c(c2=O)O)c1ccccc1 |
| Reactions | OSR0800 |
| Pathways | |
|---|---|
| KEGG | rn00941 |
| Database Links | |
|---|---|
| KEGG | C10044 |
| ChEBI | 5262 |
| Pubchem Compound | 5281616 |
| Pubchem Substance | 12230 |