RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1015 |
| Common Name | genistein |
| Formula | C15H10O5 |
| Formula at pH 7.2 (Predicted) | C15H9O5- |
| Molecular Weight | 270.241 |
| Structure |  |
| SMILES | Oc1ccc(cc1)c1coc2c(c1=O)c(O)cc(c2)O |
| Reactions | OSR0479 OSR0947 OSR0952 OSR0956 OSR1379 OSR1386 OSR1630 OSR2106 |
| Pathways | |
|---|---|
| KEGG | rn00943 |
| Metacyc | PWY-4502 PWY-2861 PWY-2343 PWY-2904 PWY-2345 PWY-2701 PWY-2561 |
| Database Links | |
|---|---|
| Gramene | CPD-3141 |