RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1017 |
| Common Name | 3-Deoxy-D-manno-octulosonate |
| Synonyms Names | KDO ;2-Dehydro-3-deoxy-D-octonate ;3-Deoxy-D-manno-2-octulosonate ;3-Deoxyoctulosonic acid |
| Formula | C8H14O8 |
| Formula at pH 7.2 (Predicted) | C8H13O8- |
| Molecular Weight | 238.192 |
| Structure |  |
| SMILES | C(O)(=O)C(=O)CC(O)C(O)C(O)C(O)CO |
| Reactions | OSR0572 OSR1297 |
| Pathways | |
|---|---|
| KEGG | rn00540 rn01100 |
| Metacyc | PWY-5111 |
| Database Links | |
|---|---|
| KEGG | C01187 |
| ChEBI | 32817 |