RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1018 |
| Common Name | Deoxyinosine |
| Formula | C10H12N4O4 |
| Formula at pH 7.2 (Predicted) | C10H12N4O4 |
| Molecular Weight | 252.227 |
| Structure |  |
| SMILES | c1(=O)(c2(c(nc[nH]1)n(cn2)[CH]3(O[CH]([CH]([CH2]3)O)CO))) |
| Reactions | OSR0486 OSR0571 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 |
| Metacyc | SALVADEHYPOX-PWY |
| Database Links | |
|---|---|
| KEGG | C05512 |
| ChEBI | 28997 |