RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1019 |
| Common Name | Porphobilinogen |
| Formula | C10H14N2O4 |
| Formula at pH 7.2 (Predicted) | C10H13N2O4- |
| Molecular Weight | 226.229 |
| Structure |  |
| SMILES | c1(c(CCC(O)=O)c(CC(O)=O)c(n1)CN) |
| Reactions | OSR1306 OSR2294 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01100 rn01110 |
| Metacyc | PWY-5188 |
| Database Links | |
|---|---|
| KEGG | C00931 |
| ChEBI | 17381 |