RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1021 |
| Common Name | Cinnavalininate |
| Formula | C14H8N2O6 |
| Formula at pH 7.2 (Predicted) | C14H6N2O62- |
| Molecular Weight | 300.223 |
| Structure |  |
| SMILES | OC(=O)c1c2nc3c(oc2cc(=O)c1N)cccc3C(=O)O |
| Reactions | OSR0369 |
| Pathways | |
|---|---|
| KEGG | rn00380 |
| Database Links | |
|---|---|
| KEGG | C05640 |
| Pubchem Compound | 114918 |
| Pubchem Substance | 7951 |