RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1022 |
| Common Name | D-Ribulose 1,5-bisphosphate |
| Synonyms Names | d-ribulose-1,5-p_{2} |
| Formula | C5H12O11P2 |
| Formula at pH 7.2 (Predicted) | C5H8O11P24- |
| Molecular Weight | 310.09 |
| Structure |  |
| SMILES | C(OP(=O)(O)O)C(O)C(O)C(=O)COP(O)(O)=O |
| Reactions | OSR0342 OSR0463 OSR1332 OSR2291 |
| Pathways | |
|---|---|
| KEGG | rn00710 rn01100 rn01120 rn00630 rn01110 |
| Metacyc | CALVIN-PWY PWY-5532 PWY-5723 |
| Database Links | |
|---|---|
| KEGG | C01182 |
| ChEBI | 16710 |
| Pubchem Compound | 123658 |
| Pubchem Substance | 4409 |