RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1024 |
| Common Name | N-Acetyl-L-citrulline |
| Formula | C8H15N3O4 |
| Formula at pH 7.2 (Predicted) | C8H14N3O4- |
| Molecular Weight | 217.222 |
| Structure |  |
| SMILES | NC(=O)NCCCC(C(=O)O)NC(=O)C |
| Reactions | OSR0470 |
| Pathways | |
|---|---|
| KEGG | rn00330 |
| Database Links | |
|---|---|
| KEGG | C15532 |
| ChEBI | 49002 |
| Pubchem Compound | 656979 |
| Pubchem Substance | 17396524 |