RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1025 |
| Common Name | N-Acetyl-D-galactosamine |
| Synonyms Names | N-Acetyl-D-chondrosamine ;2-Acetamido-2-deoxy-D-galactose |
| Formula | C8H15NO6 |
| Formula at pH 7.2 (Predicted) | C8H15NO6 |
| Molecular Weight | 221.208 |
| Structure |  |
| SMILES | OCC1OC(O)C(C(C1O)O)NC(=O)C |
| Reactions | OSR2230 |
| Pathways | |
|---|---|
| KEGG | rn00531 rn01100 |
| Database Links | |
|---|---|
| KEGG | C01132 |
| ChEBI | 28037 |
| Pubchem Compound | 35717 |
| Pubchem Substance | 4363 |