RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1031 |
| Common Name | Cytidine |
| Formula | C9H13N3O5 |
| Formula at pH 7.2 (Predicted) | C9H13N3O5 |
| Molecular Weight | 243.217 |
| Structure |  |
| SMILES | [CH]1(O[CH](CO)[CH](O)[CH](O)1)n2(c(=O)nc(N)cc2) |
| Reactions | OSR0567 OSR1250 OSR1265 OSR1270 OSR1314 OSR1323 OSR1328 OSR1342 OSR1362 OSR1465 OSR2354 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 |
| Metacyc | P1-PWY DRIBOPMET-PWY PWY0-163 |
| Database Links | |
|---|---|
| KEGG | C00475 |
| ChEBI | 17562 |