RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1032 |
| Common Name | gamma-Glutamyl-beta-cyanoalanine |
| Formula | C9H13N3O5 |
| Formula at pH 7.2 (Predicted) | C9H12N3O5- |
| Molecular Weight | 243.217 |
| Structure |  |
| SMILES | NC(C(=O)O)CCC(=O)NC(C(=O)O)CC#N |
| Reactions | OSR0483 |
| Pathways | |
|---|---|
| KEGG | rn00460 |
| Database Links | |
|---|---|
| KEGG | C05711 |
| Pubchem Compound | 53297342 |
| Pubchem Substance | 8018 |