RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1036 |
| Common Name | Aminofructose 6-phosphate |
| Synonyms Names | Amino-D-fructose 6-phosphate |
| Formula | C6H14NO8P |
| Formula at pH 7.2 (Predicted) | C6H13NO8P- |
| Molecular Weight | 259.151 |
| Structure |  |
| SMILES | OCC1(O)OC(C(C1N)O)COP(=O)(O)O |
| Reactions | OSR0938 |
| Pathways | |
|---|---|
| KEGG | rn01051 rn01110 |
| Database Links | |
|---|---|
| KEGG | C12214 |
| Pubchem Compound | 443711 |
| Pubchem Substance | 14359 |