RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1037 |
| Common Name | 5-L-Glutamyl-taurine |
| Synonyms Names | 5-Glutamyl-taurine |
| Formula | C7H14N2O6S |
| Formula at pH 7.2 (Predicted) | C7H13N2O6S- |
| Molecular Weight | 254.261 |
| Structure |  |
| SMILES | NC(CCC(=O)NCC[S](O)(=O)=O)C(O)=O |
| Reactions | OSR0645 |
| Pathways | |
|---|---|
| KEGG | rn00430 |
| Database Links | |
|---|---|
| KEGG | C05844 |
| Pubchem Compound | 68759 |
| Pubchem Substance | 8137 |