RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1038 |
| Common Name | gamma-L-Glutamyl-L-cysteine |
| Synonyms Names | L-gamma-Glutamylcysteine ;5-L-Glutamyl-L-cysteine ;gamma-Glutamylcysteine |
| Formula | C8H14N2O5S |
| Formula at pH 7.2 (Predicted) | C8H13N2O5S- |
| Molecular Weight | 250.272 |
| Structure |  |
| SMILES | C(O)(=O)C(N)CCC(=O)NC(CS)C(O)=O |
| Reactions | OSR1544 OSR2395 |
| Pathways | |
|---|---|
| KEGG | rn00480 rn01100 |
| Metacyc | GLUTATHIONESYN-PWY |
| Database Links | |
|---|---|
| KEGG | C00669 |
| ChEBI | 17515 |