RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1047 |
| Common Name | 2'-hydroxygenistein |
| Formula | C15H10O6 |
| Formula at pH 7.2 (Predicted) | C15H9O6- |
| Molecular Weight | 286.24 |
| Structure |  |
| SMILES | Oc1ccc(c(c1)O)c1coc2c(c1=O)c(O)cc(c2)O |
| Reactions | OSR0964 OSR0965 OSR0967 OSR2095 OSR2106 |
| Pathways | |
|---|---|
| Metacyc | PWY-4502 PWY-4681 |
| Database Links | |
|---|---|
| Gramene | CPD-6641 |