RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1048 |
| Common Name | Kaempferol |
| Synonyms Names | 3,4',5,7-Tetrahydroxyflavone ;4H-1-Benzopyran-4-one, 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-5,7,4'-Trihydroxyflavonol ;C.I. 75640 ;Indigo yellow ;Kaempherol ;Kempferol ;Nimbecetin ;Pelargidenolon ;Populnetin ;Rhamnolutein ;Rhamnolutin ;Robigenin ;Swartziol ;Trifolitin |
| Formula | C15H10O6 |
| Formula at pH 7.2 (Predicted) | C15H9O6- |
| Molecular Weight | 286.236 |
| Structure |  |
| SMILES | c1(O)(ccc(cc1)C2(=C(O)C(=O)c3(c(O2)cc(O)cc3O))); Oc1cc(O)c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O |
| Reactions | OSR0813 OSR1401 OSR1409 OSR1663 OSR2144 OSR2215 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01100 rn01110 rn00944 |
| Metacyc | PWY-6360 PWY-5320 PWY-5348 PWY-5321 |
| Database Links | |
|---|---|
| KEGG | C05903 |
| ChEBI | 28499 |
| Pubchem Compound | 5280863 |
| Pubchem Substance | 8191 |