RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1049 |
| Common Name | Luteolin |
| Synonyms Names | 3',4',5,7-Tetrahydroxyflavone ;5,7,3',4'-Tetrahydroxyflavone |
| Formula | C15H10O6 |
| Formula at pH 7.2 (Predicted) | C15H9O6- |
| Molecular Weight | 286.236 |
| Structure |  |
| SMILES | c1(O)(ccc(cc1)C2(=C(O)C(=O)c3(c(O2)cc(O)cc3O))); Oc1cc(O)c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O |
| Reactions | OSR1410 OSR2124 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn00944 rn01100 rn01110 |
| Metacyc | PWY-6232 |
| Database Links | |
|---|---|
| KEGG | C01514 |
| ChEBI | 15864 |
| Pubchem Compound | 5280445 |
| Pubchem Substance | 4680 |