RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1050 |
| Common Name | Pelargonidin |
| Synonyms Names | 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)benzopyrylium chloride ;3,4',5,7-Tetrahydroxyflavylium chloride ;Pelargonidin chloride ;Pelargonidol chloride |
| Formula | C15H11O5 |
| Formula at pH 7.2 (Predicted) | C15H11O5 |
| Molecular Weight | 271.245 |
| Structure |  |
| SMILES | c3(c2(O=C(c1(ccc(O)cc1))C(O)=Cc2c(O)cc(O)3)) |
| Reactions | OSR0832 OSR1648 OSR2104 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01100 rn01110 |
| Metacyc | PWY-5125 |
| Database Links | |
|---|---|
| KEGG | C05904 |