RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1051 |
| Common Name | Pinocembrin |
| Synonyms Names | 5,7-Dihydroxyflavanone |
| Formula | C15H12O4 |
| Formula at pH 7.2 (Predicted) | C15H12O4 |
| Molecular Weight | 256.253 |
| Structure |  |
| SMILES | Oc1cc2OC(CC(=O)c2c(c1)O)c1ccccc1 |
| Reactions | OSR0431 OSR0764 OSR1405 |
| Pathways | |
|---|---|
| KEGG | rn00941 |
| Metacyc | PWY-5059 |
| Database Links | |
|---|---|
| Gramene | CPD-6991 |
| KEGG | C09827 |
| Pubchem Compound | 68071 |
| Pubchem Substance | 12015 |