RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1052 |
| Common Name | Isoliquiritigenin |
| Formula | C15H12O4 |
| Formula at pH 7.2 (Predicted) | C15H12O4 |
| Molecular Weight | 256.253 |
| Structure |  |
| SMILES | OC1=CC=C(C=C1)/C=C/C(=O)C2=C(O)C=C(O)C=C2 |
| Reactions | OSR0435 OSR1406 OSR3007 OSR3008 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01110 |
| Metacyc | PWY1F-FLAVSYN |
| Database Links | |
|---|---|
| Gramene | CPD-3041 |
| KEGG | C08650 |
| ChEBI | 310312 |
| Pubchem Compound | 638278 |
| Pubchem Substance | 10843 |