RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1054 |
| Common Name | Liquiritigenin |
| Synonyms Names | 7,4'-Dihydroxyflavanone |
| Formula | C15H12O4 |
| Formula at pH 7.2 (Predicted) | C15H12O4 |
| Molecular Weight | 256.253 |
| Structure |  |
| SMILES | c3(c2(OC(c1(ccc(O)cc1))CC(=O)c2ccc(O)3)) |
| Reactions | OSR0435 OSR2134 OSR2135 OSR2140 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-3061 |
| KEGG | C09762 |
| ChEBI | 28777 |
| Pubchem Compound | 114829 |
| Pubchem Substance | 11950 |