RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1058 |
| Common Name | 5'-Deoxyadenosine |
| Formula | C10H13N5O3 |
| Formula at pH 7.2 (Predicted) | C10H13N5O3 |
| Molecular Weight | 251.242 |
| Structure |  |
| SMILES | CC1(O[CH]([CH](O)[CH]1O)n2(c3(c(nc2)c(N)ncn3))) |
| Reactions | OSR1309 OSR1491 OSR2345 OSR2495 |
| Pathways | |
|---|---|
| KEGG | rn00785 rn01100 rn00780 rn00860 rn01110 |
| Metacyc | BIOTIN-SYNTHESIS-PWY |
| Database Links | |
|---|---|
| KEGG | C05198 |
| ChEBI | 17319 |