RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1060 |
| Common Name | Thymidine |
| Synonyms Names | Deoxythymidine |
| Formula | C10H14N2O5 |
| Formula at pH 7.2 (Predicted) | C10H14N2O5 |
| Molecular Weight | 242.229 |
| Structure |  |
| SMILES | C(O)C1(OC(CC(O)1)n2(c(=O)[nH]c(=O)c(C)c2)) |
| Reactions | OSR0584 OSR0597 OSR2380 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 |
| Metacyc | P1-PWY PWY0-181 |
| Database Links | |
|---|---|
| KEGG | C00214 |
| ChEBI | 17748 |