RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1065 |
| Common Name | 2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate |
| Synonyms Names | 3-Deoxy-D-arabino-hept-2-ulosonate 7-phosphate ;3-Deoxy-arabino-heptulonate 7-phosphate ;3-Deoxy-D-arabino-heptulosonic acid 7-phosphate ;DAHP ;2-Dahp |
| Formula | C7H13O10P |
| Formula at pH 7.2 (Predicted) | C7H10O10P3- |
| Molecular Weight | 288.146 |
| Structure |  |
| SMILES | C(=O)(O)C(=O)CC(O)C(O)C(O)COP(O)(=O)O |
| Reactions | OSR0439 OSR1600 |
| Pathways | |
|---|---|
| KEGG | rn00400 rn01100 rn01110 |
| Metacyc | ARO-PWY PWY-6164 |
| Database Links | |
|---|---|
| KEGG | C04691 |
| ChEBI | 18150 |