RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1066 |
| Common Name | 2-Amino-4-hydroxy-6-(D-erythro-1,2,3-trihydroxypropyl)-7,8-dihydropteridine |
| Synonyms Names | Dihydroneopterin ;7,8-Dihydroneopterin |
| Formula | C9H13N5O4 |
| Formula at pH 7.2 (Predicted) | C9H13N5O4 |
| Molecular Weight | 255.231 |
| Structure |  |
| SMILES | NC1=NC2=C(N=C(CN2)C(O)C(O)CO)C(=O)N1 |
| Reactions | OSR0445 OSR0589 OSR0686 |
| Pathways | |
|---|---|
| KEGG | rn00790 rn01100 |
| Metacyc | FOLSYN-PWY PWY-3742 |
| Database Links | |
|---|---|
| KEGG | C04874 |
| ChEBI | 17001 |