RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1070 |
| Common Name | Some-tRNA |
| Synonyms Names | Transfer RNA ;tRNA ;tRNA(n) ;tRNA(n+1) ;C00066 |
| Formula | C10H12N3O3PS2 |
| Structure |  |
| SMILES | OCC1OC(C(O)C1O[P](O)(=O)OCC2OC(C(O)C2O[P](O)(=O)OCC3OC(C(O)C3O)[R])[R])[R] |
| Reactions | OSR1221 OSR1502 OSR1505 OSR1516 OSR2169 OSR2173 OSR2177 OSR2384 |
| Pathways | |
|---|---|
| KEGG | rn00908 rn01100 rn01110 |
| Metacyc | PWY-2781 |
| Database Links | |
|---|---|
| KEGG | C00066 |
| Pubchem Substance | 3366 |