RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1071 |
| Common Name | Aldophosphamide |
| Formula | C7H15Cl2N2O3P |
| Formula at pH 7.2 (Predicted) | C7H15Cl2N2O3P |
| Molecular Weight | 277.085 |
| Structure |  |
| SMILES | ClCCN(P(=O)(OCCC=O)N)CCCl |
| Reactions | OSR1132 OSR1999 |
| Pathways | |
|---|---|
| KEGG | rn00982 |
| Database Links | |
|---|---|
| KEGG | C07645 |
| Pubchem Compound | 107744 |
| Pubchem Substance | 9847 |