RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1072 |
| Common Name | 1-Alkenylglycerophosphoethanolamine |
| Synonyms Names | C04635 ;1-(1-Alkenyl)-sn-glycero-3-phosphoethanolamine |
| Formula | C7H15NO6PR |
| Formula at pH 7.2 (Predicted) | C7H15O6N1PR- |
| Structure |  |
| SMILES | NCCO[P](O)(=O)OCC(O)COC=C[R] |
| Reactions | OSR0512 |
| Pathways | |
|---|---|
| KEGG | rn00565 rn01100 |
| Database Links | |
|---|---|
| KEGG | C04635 |
| Pubchem Substance | 7224 |