RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1075 |
| Common Name | Quercetin |
| Synonyms Names | 3,3',4,5,7-Pentahydroxyflavone ;3,5,7,3',4'-Pentahydroxyflavone |
| Formula | C15H10O7 |
| Formula at pH 7.2 (Predicted) | C15H9O7- |
| Molecular Weight | 302.236 |
| Structure |  |
| SMILES | C2(C(O)=C(C1(=CC(O)=C(O)C=C1))OC3(=C2C(O)=CC(=C3)O))(=O) |
| Reactions | OSR0803 OSR0841 OSR1357 OSR1426 OSR1679 OSR2144 OSR2416 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn00941 rn01100 rn00944 |
| Metacyc | PWY-5125 PWY-3101 PWY-6360 PWY-5320 PWY-5348 PWY-5321 |
| Database Links | |
|---|---|
| KEGG | C00389 |
| ChEBI | 16243 |