RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1077 |
| Common Name | Cyanidin |
| Synonyms Names | 3,3',4',5,7-Pentahydroxyflavylium chloride ;Chlorure de 3,3',4',5,7-pentahydroxyflavylium ;3,3',4',5,7-Pentahydroxyflavyliumchlorid ;2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-1-benzopyrylium chloride ;3,3',4',5,7-Pentahydroxy-2-phenylbenzopyrylium chloride ;Cyanidin chloride ;Cyanidine ;Cyanidol ;Cyanidol chloride ;IdB 1027 ;cyanidin |
| Formula | C15H11O6 |
| Formula at pH 7.2 (Predicted) | C15H9O6- |
| Molecular Weight | 287.244 |
| Structure |  |
| SMILES | OC1=CC2=[O+]C(=C(O)C=C2C(=C1)O)C3=CC=C(O)C(=C3)O |
| Reactions | OSR0892 OSR0894 OSR1686 OSR2130 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01110 |
| Metacyc | PWY-5125 |
| Database Links | |
|---|---|
| Gramene | CPD-591 |
| KEGG | C05905 |
| ChEBI | 27843 |
| Pubchem Compound | 128861 |
| Pubchem Substance | 8193 |