RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1079 |
| Common Name | Garbanzol |
| Synonyms Names | 3,7,4'-Trihydroxyflavanone |
| Formula | C15H12O5 |
| Formula at pH 7.2 (Predicted) | C15H12O5 |
| Molecular Weight | 272.253 |
| Structure |  |
| SMILES | Oc1ccc(cc1)C1Oc2cc(O)ccc2C(=O)C1O |
| Reactions | OSR2109 OSR2166 |
| Pathways | |
|---|---|
| KEGG | rn00941 |
| Database Links | |
|---|---|
| KEGG | C09751 |
| Pubchem Compound | 442410 |
| Pubchem Substance | 11939 |