RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1082 |
| Common Name | Naringenin |
| Synonyms Names | 4',5,7-Trihydroxyflavanone ;(2S)-Naringenin ;(-)-(2S)-Naringenin |
| Formula | C15H12O5 |
| Formula at pH 7.2 (Predicted) | C15H12O5 |
| Molecular Weight | 272.253 |
| Structure |  |
| SMILES | c1(cc(ccc1O)[CH]2(Oc3(c(C(C2)=O)c(O)cc(c3)O))) |
| Reactions | OSR0436 OSR0452 OSR0794 OSR0795 OSR0796 OSR2116 OSR2122 OSR2161 OSR2165 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01100 rn01110 rn00943 rn00944 |
| Metacyc | PWY1F-FLAVSYN PWY-5363 PWY-2083 PWY-5060 PWY-5152 PWY1F-823 PWY-5059 PWY-3101 |
| Database Links | |
|---|---|
| KEGG | C00509 |
| ChEBI | 17846 |