RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1083 |
| Common Name | Butin |
| Synonyms Names | 7,3',4'-Trihydroxyflavanone |
| Formula | C15H12O5 |
| Formula at pH 7.2 (Predicted) | C15H12O5 |
| Molecular Weight | 272.253 |
| Structure |  |
| SMILES | Oc1ccc2c(c1)OC(CC2=O)c1ccc(c(c1)O)O |
| Reactions | OSR0451 OSR2140 |
| Pathways | |
|---|---|
| KEGG | rn00941 |
| Database Links | |
|---|---|
| KEGG | C09614 |
| Pubchem Compound | 92775 |
| Pubchem Substance | 11805 |