RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1085 |
| Common Name | Pinobanksin |
| Synonyms Names | 3,5,7-Trihydroxyflavanone |
| Formula | C15H12O5 |
| Formula at pH 7.2 (Predicted) | C15H12O5 |
| Molecular Weight | 272.253 |
| Structure |  |
| SMILES | c3(c2(OC(c1(ccccc1))C(O)C(=O)c2c(O)cc(O)3)) |
| Reactions | OSR0764 OSR0800 |
| Pathways | |
|---|---|
| KEGG | rn00941 |
| Database Links | |
|---|---|
| Gramene | CPD-6992 |
| KEGG | C09826 |
| Pubchem Compound | 73202 |
| Pubchem Substance | 12014 |