RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1087 |
| Common Name | Naringenin chalcone |
| Synonyms Names | 2',4,4',6'-Tetrahydroxychalcone ;Isosalipurpol ;Chalconaringenin ;trans-3'-hydroxycotinine ;naringenin chalcone |
| Formula | C15H12O5 |
| Formula at pH 7.2 (Predicted) | C15H12O5 |
| Molecular Weight | 272.253 |
| Structure |  |
| SMILES | OC1=CC=C(C=C1)/C=C/C(=O)C2=C(O)C=C(O)C=C2O |
| Reactions | OSR0452 OSR1567 OSR2075 OSR2958 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01100 rn01110 |
| Metacyc | PWY66-221 PWY1F-FLAVSYN |
| Database Links | |
|---|---|
| Gramene | CPD-2750 |
| KEGG | C06561 |
| ChEBI | 15413 |
| Pubchem Compound | 5280960 |
| Pubchem Substance | 8790 |